C26H32O6 — CID 58834251
CID 58834251 (PubChem CID 58834251) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol.
| Compound Name | CID 58834251 |
|---|---|
| PubChem CID | 58834251 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | — |
| SMILES | COC(=O)C1C2C3CC[C@@]4(CCC(=O)O4)[C@@]3(C)C[C@@H]3O[C@@]23[C@@]2(C)CCC(=O)C=C2C12CC2 |
| InChI | InChI=1S/C26H32O6/c1-22-7-4-14(27)12-16(22)24(10-11-24)20(21(29)30-3)19-15-5-8-25(9-6-18(28)32-25)23(15,2)13-17-26(19,22)31-17/h12,15,17,19-20H,4-11,13H2,1-3H3/t15?,17-,19?,20?,22-,23-,25+,26+/m0/s1 |
| InChIKey | NBGRPRRUNJCREX-YBSSEVBSSA-N |
| XLogP | 3.51 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|