C10H9ClN6O2 — CID 102918947
3-[(5-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-1-methylpyrrolidine-2,5-dione (PubChem CID 102918947) has the molecular formula C10H9ClN6O2 and a molecular weight of 280.68 g/mol. Its IUPAC name is 3-[(5-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[(5-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 102918947 |
| Molecular Formula | C10H9ClN6O2 |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-[(5-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(Nc2cc(Cl)nc3ncnn23)C1=O |
| InChI | InChI=1S/C10H9ClN6O2/c1-16-8(18)2-5(9(16)19)14-7-3-6(11)15-10-12-4-13-17(7)10/h3-5,14H,2H2,1H3 |
| InChIKey | UJCKCXJHDAVBDH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|