C18H18N6O2 — CID 133345012
3-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 133345012) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 3-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-1-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-1-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 133345012 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC(C)N1C(=O)CC(Nc2cc(-c3ccccc3)nc3ncnn23)C1=O |
| InChI | InChI=1S/C18H18N6O2/c1-11(2)23-16(25)9-14(17(23)26)21-15-8-13(12-6-4-3-5-7-12)22-18-19-10-20-24(15)18/h3-8,10-11,14,21H,9H2,1-2H3 |
| InChIKey | NIWDIWCWSKGRGR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|