C13H16FNO5S — CID 102919665
4-fluoro-2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]sulfonylbenzoic acid (PubChem CID 102919665) has the molecular formula C13H16FNO5S and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-fluoro-2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-fluoro-2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 102919665 |
| Molecular Formula | C13H16FNO5S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-fluoro-2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]sulfonylbenzoic acid |
| SMILES | CC1CCN(S(=O)(=O)c2cc(F)ccc2C(=O)O)C1CO |
| InChI | InChI=1S/C13H16FNO5S/c1-8-4-5-15(11(8)7-16)21(19,20)12-6-9(14)2-3-10(12)13(17)18/h2-3,6,8,11,16H,4-5,7H2,1H3,(H,17,18) |
| InChIKey | JJGGRKMABDRKSE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |