C14H21FN2O3S — CID 107326291
[1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylpyrrolidin-2-yl]methanol (PubChem CID 107326291) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is [1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylpyrrolidin-2-yl]methanol.
| Compound Name | [1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 107326291 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | [1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylpyrrolidin-2-yl]methanol |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)N1CCC(C)C1CO |
| InChI | InChI=1S/C14H21FN2O3S/c1-8-4-5-17(12(8)7-18)21(19,20)14-9(2)6-11(15)13(16)10(14)3/h6,8,12,18H,4-5,7,16H2,1-3H3 |
| InChIKey | CFMCONUHWYCDGL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|