C14H21FN2O2S2 — CID 102920286
N-[(4-fluoro-2-thiomorpholin-4-ylsulfonylphenyl)methyl]propan-2-amine (PubChem CID 102920286) has the molecular formula C14H21FN2O2S2 and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[(4-fluoro-2-thiomorpholin-4-ylsulfonylphenyl)methyl]propan-2-amine.
| Compound Name | N-[(4-fluoro-2-thiomorpholin-4-ylsulfonylphenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 102920286 |
| Molecular Formula | C14H21FN2O2S2 |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[(4-fluoro-2-thiomorpholin-4-ylsulfonylphenyl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(F)cc1S(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C14H21FN2O2S2/c1-11(2)16-10-12-3-4-13(15)9-14(12)21(18,19)17-5-7-20-8-6-17/h3-4,9,11,16H,5-8,10H2,1-2H3 |
| InChIKey | MEPKWRSVUAFERN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |