C15H25FN2O2S — CID 106031452
5-fluoro-N-(2-methylbutan-2-yl)-2-[(propan-2-ylamino)methyl]benzenesulfonamide (PubChem CID 106031452) has the molecular formula C15H25FN2O2S and a molecular weight of 316.44 g/mol. Its IUPAC name is 5-fluoro-N-(2-methylbutan-2-yl)-2-[(propan-2-ylamino)methyl]benzenesulfonamide.
| Compound Name | 5-fluoro-N-(2-methylbutan-2-yl)-2-[(propan-2-ylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106031452 |
| Molecular Formula | C15H25FN2O2S |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 5-fluoro-N-(2-methylbutan-2-yl)-2-[(propan-2-ylamino)methyl]benzenesulfonamide |
| SMILES | CCC(C)(C)NS(=O)(=O)c1cc(F)ccc1CNC(C)C |
| InChI | InChI=1S/C15H25FN2O2S/c1-6-15(4,5)18-21(19,20)14-9-13(16)8-7-12(14)10-17-11(2)3/h7-9,11,17-18H,6,10H2,1-5H3 |
| InChIKey | AWKOVVTYSLNXNK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |