C19H27N3O4 — CID 10292070
(4S)-N-hydroxy-3-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-4-methylhexanamide (PubChem CID 10292070) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (4S)-N-hydroxy-3-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-4-methylhexanamide.
| Compound Name | (4S)-N-hydroxy-3-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-4-methylhexanamide |
|---|---|
| PubChem CID | 10292070 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (4S)-N-hydroxy-3-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-4-methylhexanamide |
| SMILES | CC[C@H](C)C(CC(=O)NO)NC(=O)Cc1c(C)[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C19H27N3O4/c1-5-11(2)17(10-19(24)22-25)21-18(23)9-14-12(3)20-16-7-6-13(26-4)8-15(14)16/h6-8,11,17,20,25H,5,9-10H2,1-4H3,(H,21,23)(H,22,24)/t11-,17?/m0/s1 |
| InChIKey | PRXHZFDEVXHOPU-PIJUOJQZSA-N |
| XLogP | 2.45 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|