C19H18N2O4 — CID 113212238
N-(1,3-benzodioxol-5-yl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide (PubChem CID 113212238) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 113212238 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)Nc3ccc4c(c3)OCO4)c2c1 |
| InChI | InChI=1S/C19H18N2O4/c1-11-14(15-8-13(23-2)4-5-16(15)20-11)9-19(22)21-12-3-6-17-18(7-12)25-10-24-17/h3-8,20H,9-10H2,1-2H3,(H,21,22) |
| InChIKey | DZTXFVGOTDITLH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|