C14H11Cl2N5 — CID 102921972
4-(3,4-dichlorophenyl)-1-methyl-3-pyrimidin-5-ylpyrazol-5-amine (PubChem CID 102921972) has the molecular formula C14H11Cl2N5 and a molecular weight of 320.18 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-1-methyl-3-pyrimidin-5-ylpyrazol-5-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-1-methyl-3-pyrimidin-5-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 102921972 |
| Molecular Formula | C14H11Cl2N5 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-1-methyl-3-pyrimidin-5-ylpyrazol-5-amine |
| SMILES | Cn1nc(-c2cncnc2)c(-c2ccc(Cl)c(Cl)c2)c1N |
| InChI | InChI=1S/C14H11Cl2N5/c1-21-14(17)12(8-2-3-10(15)11(16)4-8)13(20-21)9-5-18-7-19-6-9/h2-7H,17H2,1H3 |
| InChIKey | MLJSGARTWZHAKW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |