C16H13Cl2N3 — CID 43336366
3-(3,4-dichlorophenyl)-1-methyl-4-phenylpyrazol-5-amine (PubChem CID 43336366) has the molecular formula C16H13Cl2N3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-methyl-4-phenylpyrazol-5-amine.
| Compound Name | 3-(3,4-dichlorophenyl)-1-methyl-4-phenylpyrazol-5-amine |
|---|---|
| PubChem CID | 43336366 |
| Molecular Formula | C16H13Cl2N3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-methyl-4-phenylpyrazol-5-amine |
| SMILES | Cn1nc(-c2ccc(Cl)c(Cl)c2)c(-c2ccccc2)c1N |
| InChI | InChI=1S/C16H13Cl2N3/c1-21-16(19)14(10-5-3-2-4-6-10)15(20-21)11-7-8-12(17)13(18)9-11/h2-9H,19H2,1H3 |
| InChIKey | JKNSVFARSMZXOC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |