C14H22N2O5 — CID 102926987
2-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohexane-1-carboxylic acid (PubChem CID 102926987) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102926987 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohexane-1-carboxylic acid |
| SMILES | COCCOCCc1noc(C2CCCCC2C(=O)O)n1 |
| InChI | InChI=1S/C14H22N2O5/c1-19-8-9-20-7-6-12-15-13(21-16-12)10-4-2-3-5-11(10)14(17)18/h10-11H,2-9H2,1H3,(H,17,18) |
| InChIKey | RBAZGZGVDNXCRG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|