C13H16F2N2O4 — CID 103146481
(1S,6R)-6-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 103146481) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is (1S,6R)-6-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 103146481 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (1S,6R)-6-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1c1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C13H16F2N2O4/c14-10(15)7-20-6-5-11-16-12(21-17-11)8-3-1-2-4-9(8)13(18)19/h1-2,8-10H,3-7H2,(H,18,19)/t8-,9+/m1/s1 |
| InChIKey | VINAMFWPENOSNX-BDAKNGLRSA-N |
| XLogP | 2.03 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|