C12H13F3N2O4 — CID 103473202
(1S,6R)-6-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 103473202) has the molecular formula C12H13F3N2O4 and a molecular weight of 306.24 g/mol. Its IUPAC name is (1S,6R)-6-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 103473202 |
| Molecular Formula | C12H13F3N2O4 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (1S,6R)-6-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1c1nc(COCC(F)(F)F)no1 |
| InChI | InChI=1S/C12H13F3N2O4/c13-12(14,15)6-20-5-9-16-10(21-17-9)7-3-1-2-4-8(7)11(18)19/h1-2,7-8H,3-6H2,(H,18,19)/t7-,8+/m1/s1 |
| InChIKey | XXVFJGKJBZGLQC-SFYZADRCSA-N |
| XLogP | 2.28 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|