C11H17F3N2O2S — CID 102929654
1,1,1-trifluoro-2-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]propan-2-amine (PubChem CID 102929654) has the molecular formula C11H17F3N2O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]propan-2-amine.
| Compound Name | 1,1,1-trifluoro-2-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 102929654 |
| Molecular Formula | C11H17F3N2O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1,1,1-trifluoro-2-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]propan-2-amine |
| SMILES | COCCOCCc1nc(C(C)(N)C(F)(F)F)cs1 |
| InChI | InChI=1S/C11H17F3N2O2S/c1-10(15,11(12,13)14)8-7-19-9(16-8)3-4-18-6-5-17-2/h7H,3-6,15H2,1-2H3 |
| InChIKey | QMMJRLOQIVDXKM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|