About 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine
2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine (PubChem CID 96864974) has the molecular formula C7H9F3N2S
and a molecular weight of 210.22 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine.
Analyze 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine?
The IUPAC name of 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine (CID 96864974) is 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine.
What is the SMILES notation for 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine?
The canonical SMILES for 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine is CC(C)(N)c1csc(C(F)(F)F)n1.
What is the InChIKey of 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine?
The InChIKey is CNKJOKRUPOLIGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2S/c1-6(2,11)4-3-13-5(12-4)7(8,9)10/h3H,11H2,1-2H3.
What are the key properties of 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine?
2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine has a molecular weight of 210.22 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(trifluoromethyl)-1,3-thiazol-4-yl]propan-2-amine is sourced from PubChem (CID 96864974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).