C12H22N2O2S — CID 102929666
1-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]butan-1-amine (PubChem CID 102929666) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]butan-1-amine.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 102929666 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]butan-1-amine |
| SMILES | CCCC(N)c1csc(CCOCCOC)n1 |
| InChI | InChI=1S/C12H22N2O2S/c1-3-4-10(13)11-9-17-12(14-11)5-6-16-8-7-15-2/h9-10H,3-8,13H2,1-2H3 |
| InChIKey | BTXRNGCMLRCDOW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|