C10H17NO3S — CID 102928798
1-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]ethanol (PubChem CID 102928798) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]ethanol.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 102928798 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-4-yl]ethanol |
| SMILES | COCCOCCc1nc(C(C)O)cs1 |
| InChI | InChI=1S/C10H17NO3S/c1-8(12)9-7-15-10(11-9)3-4-14-6-5-13-2/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | URSTXPQNBFXHOK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|