C13H18F3N3O2 — CID 102929696
2-[2-(2-methoxyethoxy)ethyl]-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 102929696) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethyl]-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 2-[2-(2-methoxyethoxy)ethyl]-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 102929696 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethyl]-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | COCCOCCc1nc2c(c(C(F)(F)F)n1)CNCC2 |
| InChI | InChI=1S/C13H18F3N3O2/c1-20-6-7-21-5-3-11-18-10-2-4-17-8-9(10)12(19-11)13(14,15)16/h17H,2-8H2,1H3 |
| InChIKey | ITIVAYBJIRAXQC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|