C11H22N2O5S — CID 102932507
2-amino-1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-4-methylsulfonylbutan-1-one (PubChem CID 102932507) has the molecular formula C11H22N2O5S and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-amino-1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-4-methylsulfonylbutan-1-one.
| Compound Name | 2-amino-1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 102932507 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-amino-1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-4-methylsulfonylbutan-1-one |
| SMILES | CC1CN(C(=O)C(N)CCS(C)(=O)=O)CC(CO)O1 |
| InChI | InChI=1S/C11H22N2O5S/c1-8-5-13(6-9(7-14)18-8)11(15)10(12)3-4-19(2,16)17/h8-10,14H,3-7,12H2,1-2H3 |
| InChIKey | OBVYNBYHNOEHOJ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |