C12H17N3O4 — CID 102935159
methyl 6-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]pyridazine-3-carboxylate (PubChem CID 102935159) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl 6-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 102935159 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | methyl 6-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CC(C)OC(CO)C2)nn1 |
| InChI | InChI=1S/C12H17N3O4/c1-8-5-15(6-9(7-16)19-8)11-4-3-10(13-14-11)12(17)18-2/h3-4,8-9,16H,5-7H2,1-2H3 |
| InChIKey | SIBBQVAZRIZAOZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |