About methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate
methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate (PubChem CID 129497950) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate |
| PubChem CID | 129497950 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(N2C[C@H](C)O[C@@H](C)C2)ncn1 |
| InChI | InChI=1S/C12H17N3O3/c1-8-5-15(6-9(2)18-8)11-4-10(12(16)17-3)13-7-14-11/h4,7-9H,5-6H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | KXQNACNHNIGVHV-IUCAKERBSA-N |
| XLogP | 0.88 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate?
The IUPAC name of methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate (CID 129497950) is methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate.
What is the SMILES notation for methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate?
The canonical SMILES for methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate is COC(=O)c1cc(N2C[C@H](C)O[C@@H](C)C2)ncn1.
What is the InChIKey of methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate?
The InChIKey is KXQNACNHNIGVHV-IUCAKERBSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-8-5-15(6-9(2)18-8)11-4-10(12(16)17-3)13-7-14-11/h4,7-9H,5-6H2,1-3H3/t8-,9-/m0/s1.
What are the key properties of methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate?
methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate has a molecular weight of 251.29 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboxylate is sourced from PubChem (CID 129497950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).