C11H14F3N3O — CID 172900300
2,6-dimethyl-4-[6-(trifluoromethyl)pyrimidin-4-yl]morpholine (PubChem CID 172900300) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 2,6-dimethyl-4-[6-(trifluoromethyl)pyrimidin-4-yl]morpholine.
| Compound Name | 2,6-dimethyl-4-[6-(trifluoromethyl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 172900300 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2,6-dimethyl-4-[6-(trifluoromethyl)pyrimidin-4-yl]morpholine |
| SMILES | CC1CN(c2cc(C(F)(F)F)ncn2)CC(C)O1 |
| InChI | InChI=1S/C11H14F3N3O/c1-7-4-17(5-8(2)18-7)10-3-9(11(12,13)14)15-6-16-10/h3,6-8H,4-5H2,1-2H3 |
| InChIKey | ZIAFQSDLSGMTOE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |