C10H10F5N3 — CID 166602956
4-[3-(difluoromethyl)pyrrolidin-1-yl]-6-(trifluoromethyl)pyrimidine (PubChem CID 166602956) has the molecular formula C10H10F5N3 and a molecular weight of 267.20 g/mol. Its IUPAC name is 4-[3-(difluoromethyl)pyrrolidin-1-yl]-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-[3-(difluoromethyl)pyrrolidin-1-yl]-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 166602956 |
| Molecular Formula | C10H10F5N3 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-[3-(difluoromethyl)pyrrolidin-1-yl]-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)C1CCN(c2cc(C(F)(F)F)ncn2)C1 |
| InChI | InChI=1S/C10H10F5N3/c11-9(12)6-1-2-18(4-6)8-3-7(10(13,14)15)16-5-17-8/h3,5-6,9H,1-2,4H2 |
| InChIKey | LBQCUYVIBABLGD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |