C11H12F3N7O — CID 164694842
2-(2-methyltetrazol-5-yl)-4-[6-(trifluoromethyl)pyrimidin-4-yl]morpholine (PubChem CID 164694842) has the molecular formula C11H12F3N7O and a molecular weight of 315.26 g/mol. Its IUPAC name is 2-(2-methyltetrazol-5-yl)-4-[6-(trifluoromethyl)pyrimidin-4-yl]morpholine.
| Compound Name | 2-(2-methyltetrazol-5-yl)-4-[6-(trifluoromethyl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 164694842 |
| Molecular Formula | C11H12F3N7O |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-(2-methyltetrazol-5-yl)-4-[6-(trifluoromethyl)pyrimidin-4-yl]morpholine |
| SMILES | Cn1nnc(C2CN(c3cc(C(F)(F)F)ncn3)CCO2)n1 |
| InChI | InChI=1S/C11H12F3N7O/c1-20-18-10(17-19-20)7-5-21(2-3-22-7)9-4-8(11(12,13)14)15-6-16-9/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | UKASHGGLFFLDQG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |