C15H22N8O2 — CID 162633573
1-[6-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]pyrimidin-4-yl]piperidin-4-ol (PubChem CID 162633573) has the molecular formula C15H22N8O2 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[6-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]pyrimidin-4-yl]piperidin-4-ol.
| Compound Name | 1-[6-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]pyrimidin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 162633573 |
| Molecular Formula | C15H22N8O2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[6-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]pyrimidin-4-yl]piperidin-4-ol |
| SMILES | Cn1nnnc1C1CN(c2cc(N3CCC(O)CC3)ncn2)CCO1 |
| InChI | InChI=1S/C15H22N8O2/c1-21-15(18-19-20-21)12-9-23(6-7-25-12)14-8-13(16-10-17-14)22-4-2-11(24)3-5-22/h8,10-12,24H,2-7,9H2,1H3 |
| InChIKey | AQHRLDJWNBRSRQ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |