C15H19N3O2 — CID 133133388
methyl 6-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyrimidine-4-carboxylate (PubChem CID 133133388) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is methyl 6-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyrimidine-4-carboxylate.
| Compound Name | methyl 6-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 133133388 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | methyl 6-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(N2C[C@H]3CC(C)=CC[C@H]3C2)ncn1 |
| InChI | InChI=1S/C15H19N3O2/c1-10-3-4-11-7-18(8-12(11)5-10)14-6-13(15(19)20-2)16-9-17-14/h3,6,9,11-12H,4-5,7-8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | UNBPIJFLAYAOKP-NWDGAFQWSA-N |
| XLogP | 2.06 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|