C14H19N3O — CID 56887854
(3aR,7aS)-2-(6-methoxypyrimidin-4-yl)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 56887854) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is (3aR,7aS)-2-(6-methoxypyrimidin-4-yl)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aR,7aS)-2-(6-methoxypyrimidin-4-yl)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 56887854 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (3aR,7aS)-2-(6-methoxypyrimidin-4-yl)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | COc1cc(N2C[C@H]3CC=C(C)C[C@H]3C2)ncn1 |
| InChI | InChI=1S/C14H19N3O/c1-10-3-4-11-7-17(8-12(11)5-10)13-6-14(18-2)16-9-15-13/h3,6,9,11-12H,4-5,7-8H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | TUJBWFVJCDWXKQ-NEPJUHHUSA-N |
| XLogP | 2.28 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|