C18H26N4 — CID 56722184
(3aR,7aS)-5-methyl-2-(6-piperidin-4-ylpyrimidin-4-yl)-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 56722184) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is (3aR,7aS)-5-methyl-2-(6-piperidin-4-ylpyrimidin-4-yl)-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aR,7aS)-5-methyl-2-(6-piperidin-4-ylpyrimidin-4-yl)-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 56722184 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | (3aR,7aS)-5-methyl-2-(6-piperidin-4-ylpyrimidin-4-yl)-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | CC1=CC[C@@H]2CN(c3cc(C4CCNCC4)ncn3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H26N4/c1-13-2-3-15-10-22(11-16(15)8-13)18-9-17(20-12-21-18)14-4-6-19-7-5-14/h2,9,12,14-16,19H,3-8,10-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | GJBWXHMFRUXTPD-CVEARBPZSA-N |
| XLogP | 2.74 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|