C11H16N4 — CID 126848081
[1-(6-cyclopropylpyrimidin-4-yl)azetidin-3-yl]methanamine (PubChem CID 126848081) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is [1-(6-cyclopropylpyrimidin-4-yl)azetidin-3-yl]methanamine.
| Compound Name | [1-(6-cyclopropylpyrimidin-4-yl)azetidin-3-yl]methanamine |
|---|---|
| PubChem CID | 126848081 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [1-(6-cyclopropylpyrimidin-4-yl)azetidin-3-yl]methanamine |
| SMILES | NCC1CN(c2cc(C3CC3)ncn2)C1 |
| InChI | InChI=1S/C11H16N4/c12-4-8-5-15(6-8)11-3-10(9-1-2-9)13-7-14-11/h3,7-9H,1-2,4-6,12H2 |
| InChIKey | DKCPFQHPFFGGIF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |