C15H20N4O — CID 165434882
[1-(6-cyclopropylpyrimidin-4-yl)azetidin-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 165434882) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is [1-(6-cyclopropylpyrimidin-4-yl)azetidin-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(6-cyclopropylpyrimidin-4-yl)azetidin-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 165434882 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [1-(6-cyclopropylpyrimidin-4-yl)azetidin-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CN(c2cc(C3CC3)ncn2)C1)N1CCCC1 |
| InChI | InChI=1S/C15H20N4O/c20-15(18-5-1-2-6-18)12-8-19(9-12)14-7-13(11-3-4-11)16-10-17-14/h7,10-12H,1-6,8-9H2 |
| InChIKey | VTKWTWJXNLBCGD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |