C22H33N5O — CID 56872253
[1-[1-(6-cyclopropylpyrimidin-4-yl)piperidin-4-yl]piperidin-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 56872253) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is [1-[1-(6-cyclopropylpyrimidin-4-yl)piperidin-4-yl]piperidin-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-[1-(6-cyclopropylpyrimidin-4-yl)piperidin-4-yl]piperidin-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 56872253 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | [1-[1-(6-cyclopropylpyrimidin-4-yl)piperidin-4-yl]piperidin-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CCCN(C2CCN(c3cc(C4CC4)ncn3)CC2)C1)N1CCCC1 |
| InChI | InChI=1S/C22H33N5O/c28-22(26-9-1-2-10-26)18-4-3-11-27(15-18)19-7-12-25(13-8-19)21-14-20(17-5-6-17)23-16-24-21/h14,16-19H,1-13,15H2 |
| InChIKey | NJOAQNRETXTJDK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |