C18H29N5O — CID 97402573
(3aS,7aS)-2-(6-methoxypyrimidin-4-yl)-5-(2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 97402573) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is (3aS,7aS)-2-(6-methoxypyrimidin-4-yl)-5-(2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine.
| Compound Name | (3aS,7aS)-2-(6-methoxypyrimidin-4-yl)-5-(2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 97402573 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | (3aS,7aS)-2-(6-methoxypyrimidin-4-yl)-5-(2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | COc1cc(N2C[C@H]3CCN(CCN4CCCC4)C[C@H]3C2)ncn1 |
| InChI | InChI=1S/C18H29N5O/c1-24-18-10-17(19-14-20-18)23-12-15-4-7-22(11-16(15)13-23)9-8-21-5-2-3-6-21/h10,14-16H,2-9,11-13H2,1H3/t15-,16+/m1/s1 |
| InChIKey | IAWAPKAKNAYEPZ-CVEARBPZSA-N |
| XLogP | 1.34 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |