C14H24N2O3 — CID 102935623
2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 102935623) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 102935623 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN1CC(C)OC(CO)C1 |
| InChI | InChI=1S/C14H24N2O3/c1-4-6-16(7-5-2)14(18)10-15-8-12(3)19-13(9-15)11-17/h4-5,12-13,17H,1-2,6-11H2,3H3 |
| InChIKey | FVPJHUZEFMCQEE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|