C12H24ClNO — CID 102936701
2-(chloromethyl)-4-(3,3-dimethylbutyl)-6-methylmorpholine (PubChem CID 102936701) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(3,3-dimethylbutyl)-6-methylmorpholine.
| Compound Name | 2-(chloromethyl)-4-(3,3-dimethylbutyl)-6-methylmorpholine |
|---|---|
| PubChem CID | 102936701 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-(chloromethyl)-4-(3,3-dimethylbutyl)-6-methylmorpholine |
| SMILES | CC1CN(CCC(C)(C)C)CC(CCl)O1 |
| InChI | InChI=1S/C12H24ClNO/c1-10-8-14(6-5-12(2,3)4)9-11(7-13)15-10/h10-11H,5-9H2,1-4H3 |
| InChIKey | GVNGQMFBSBHXQI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|