C14H17BrF3NO — CID 102936816
2-(bromomethyl)-6-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]morpholine (PubChem CID 102936816) has the molecular formula C14H17BrF3NO and a molecular weight of 352.19 g/mol. Its IUPAC name is 2-(bromomethyl)-6-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]morpholine.
| Compound Name | 2-(bromomethyl)-6-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 102936816 |
| Molecular Formula | C14H17BrF3NO |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-(bromomethyl)-6-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]morpholine |
| SMILES | CC1CN(Cc2ccc(C(F)(F)F)cc2)CC(CBr)O1 |
| InChI | InChI=1S/C14H17BrF3NO/c1-10-7-19(9-13(6-15)20-10)8-11-2-4-12(5-3-11)14(16,17)18/h2-5,10,13H,6-9H2,1H3 |
| InChIKey | SORMJXNPTYOEJB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|