C16H18F3N — CID 57116775
(3aS,7aR)-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 57116775) has the molecular formula C16H18F3N and a molecular weight of 281.32 g/mol. Its IUPAC name is (3aS,7aR)-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aS,7aR)-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 57116775 |
| Molecular Formula | C16H18F3N |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3aS,7aR)-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | FC(F)(F)c1ccc(CN2C[C@H]3CC=CC[C@H]3C2)cc1 |
| InChI | InChI=1S/C16H18F3N/c17-16(18,19)15-7-5-12(6-8-15)9-20-10-13-3-1-2-4-14(13)11-20/h1-2,5-8,13-14H,3-4,9-11H2/t13-,14+ |
| InChIKey | KCEZBLBECJVTFQ-OKILXGFUSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|