C13H17ClN4O — CID 102937075
2-(chloromethyl)-6-methyl-4-(2-methylpyrazolo[1,5-a]pyrazin-4-yl)morpholine (PubChem CID 102937075) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is 2-(chloromethyl)-6-methyl-4-(2-methylpyrazolo[1,5-a]pyrazin-4-yl)morpholine.
| Compound Name | 2-(chloromethyl)-6-methyl-4-(2-methylpyrazolo[1,5-a]pyrazin-4-yl)morpholine |
|---|---|
| PubChem CID | 102937075 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-(chloromethyl)-6-methyl-4-(2-methylpyrazolo[1,5-a]pyrazin-4-yl)morpholine |
| SMILES | Cc1cc2c(N3CC(C)OC(CCl)C3)nccn2n1 |
| InChI | InChI=1S/C13H17ClN4O/c1-9-5-12-13(15-3-4-18(12)16-9)17-7-10(2)19-11(6-14)8-17/h3-5,10-11H,6-8H2,1-2H3 |
| InChIKey | OGHNPPKWERDHTG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|