C14H20BrNO3S — CID 102937216
2-(bromomethyl)-4-(4-ethylsulfonylphenyl)-6-methylmorpholine (PubChem CID 102937216) has the molecular formula C14H20BrNO3S and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(4-ethylsulfonylphenyl)-6-methylmorpholine.
| Compound Name | 2-(bromomethyl)-4-(4-ethylsulfonylphenyl)-6-methylmorpholine |
|---|---|
| PubChem CID | 102937216 |
| Molecular Formula | C14H20BrNO3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-(bromomethyl)-4-(4-ethylsulfonylphenyl)-6-methylmorpholine |
| SMILES | CCS(=O)(=O)c1ccc(N2CC(C)OC(CBr)C2)cc1 |
| InChI | InChI=1S/C14H20BrNO3S/c1-3-20(17,18)14-6-4-12(5-7-14)16-9-11(2)19-13(8-15)10-16/h4-7,11,13H,3,8-10H2,1-2H3 |
| InChIKey | OGDHHXSEOPOBRN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|