C13H13Br2F2NO2 — CID 102937775
(4-bromo-2,6-difluorophenyl)-[2-(bromomethyl)-6-methylmorpholin-4-yl]methanone (PubChem CID 102937775) has the molecular formula C13H13Br2F2NO2 and a molecular weight of 413.06 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-[2-(bromomethyl)-6-methylmorpholin-4-yl]methanone.
| Compound Name | (4-bromo-2,6-difluorophenyl)-[2-(bromomethyl)-6-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 102937775 |
| Molecular Formula | C13H13Br2F2NO2 |
| Molecular Weight | 413.06 g/mol |
| Exact Mass | 410.93 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-[2-(bromomethyl)-6-methylmorpholin-4-yl]methanone |
| SMILES | CC1CN(C(=O)c2c(F)cc(Br)cc2F)CC(CBr)O1 |
| InChI | InChI=1S/C13H13Br2F2NO2/c1-7-5-18(6-9(4-14)20-7)13(19)12-10(16)2-8(15)3-11(12)17/h2-3,7,9H,4-6H2,1H3 |
| InChIKey | HSXJYJURGRQPEC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.06 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|