C11H14BrN3O4 — CID 102937847
[2-(bromomethyl)-6-methylmorpholin-4-yl]-(4-nitro-1H-pyrrol-2-yl)methanone (PubChem CID 102937847) has the molecular formula C11H14BrN3O4 and a molecular weight of 332.15 g/mol. Its IUPAC name is [2-(bromomethyl)-6-methylmorpholin-4-yl]-(4-nitro-1H-pyrrol-2-yl)methanone.
| Compound Name | [2-(bromomethyl)-6-methylmorpholin-4-yl]-(4-nitro-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 102937847 |
| Molecular Formula | C11H14BrN3O4 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | [2-(bromomethyl)-6-methylmorpholin-4-yl]-(4-nitro-1H-pyrrol-2-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc([N+](=O)[O-])c[nH]2)CC(CBr)O1 |
| InChI | InChI=1S/C11H14BrN3O4/c1-7-5-14(6-9(3-12)19-7)11(16)10-2-8(4-13-10)15(17)18/h2,4,7,9,13H,3,5-6H2,1H3 |
| InChIKey | UKHHXHKKKOOPOE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|