C9H17NO5 — CID 102938985
2-hydroxyethyl 2-(hydroxymethyl)-6-methylmorpholine-4-carboxylate (PubChem CID 102938985) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-hydroxyethyl 2-(hydroxymethyl)-6-methylmorpholine-4-carboxylate.
| Compound Name | 2-hydroxyethyl 2-(hydroxymethyl)-6-methylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 102938985 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-hydroxyethyl 2-(hydroxymethyl)-6-methylmorpholine-4-carboxylate |
| SMILES | CC1CN(C(=O)OCCO)CC(CO)O1 |
| InChI | InChI=1S/C9H17NO5/c1-7-4-10(5-8(6-12)15-7)9(13)14-3-2-11/h7-8,11-12H,2-6H2,1H3 |
| InChIKey | JIBRNDGZIVJDIU-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |