C9H7IN2O — CID 102941594
3-iodo-8-methyl-1H-1,7-naphthyridin-4-one (PubChem CID 102941594) has the molecular formula C9H7IN2O and a molecular weight of 286.07 g/mol. Its IUPAC name is 3-iodo-8-methyl-1H-1,7-naphthyridin-4-one.
| Compound Name | 3-iodo-8-methyl-1H-1,7-naphthyridin-4-one |
|---|---|
| PubChem CID | 102941594 |
| Molecular Formula | C9H7IN2O |
| Molecular Weight | 286.07 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | 3-iodo-8-methyl-1H-1,7-naphthyridin-4-one |
| SMILES | Cc1nccc2c(=O)c(I)c[nH]c12 |
| InChI | InChI=1S/C9H7IN2O/c1-5-8-6(2-3-11-5)9(13)7(10)4-12-8/h2-4H,1H3,(H,12,13) |
| InChIKey | VUGQKQBRJLSTQF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.07 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|