C10H9ClN2O — CID 102941601
3-chloro-6,8-dimethyl-1H-1,7-naphthyridin-4-one (PubChem CID 102941601) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is 3-chloro-6,8-dimethyl-1H-1,7-naphthyridin-4-one.
| Compound Name | 3-chloro-6,8-dimethyl-1H-1,7-naphthyridin-4-one |
|---|---|
| PubChem CID | 102941601 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 3-chloro-6,8-dimethyl-1H-1,7-naphthyridin-4-one |
| SMILES | Cc1cc2c(=O)c(Cl)c[nH]c2c(C)n1 |
| InChI | InChI=1S/C10H9ClN2O/c1-5-3-7-9(6(2)13-5)12-4-8(11)10(7)14/h3-4H,1-2H3,(H,12,14) |
| InChIKey | WHJHIWVDJVNTLA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |