C10H11ClN2O — CID 102942271
1-(2-chloroethyl)-5-methyl-6H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 102942271) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is 1-(2-chloroethyl)-5-methyl-6H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 1-(2-chloroethyl)-5-methyl-6H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 102942271 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-(2-chloroethyl)-5-methyl-6H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cc1cc2ccn(CCCl)c2c(=O)[nH]1 |
| InChI | InChI=1S/C10H11ClN2O/c1-7-6-8-2-4-13(5-3-11)9(8)10(14)12-7/h2,4,6H,3,5H2,1H3,(H,12,14) |
| InChIKey | JMGTXWKHPNEKNL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|