C8H10ClNO — CID 82526324
3-(chloromethyl)-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 82526324) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is 3-(chloromethyl)-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-(chloromethyl)-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 82526324 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3-(chloromethyl)-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C)c(CCl)c(=O)[nH]1 |
| InChI | InChI=1S/C8H10ClNO/c1-5-3-6(2)10-8(11)7(5)4-9/h3H,4H2,1-2H3,(H,10,11) |
| InChIKey | KMPGZPMOUOBPFK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|