C8H8N2O — CID 140776702
3-isocyano-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 140776702) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 3-isocyano-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-isocyano-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 140776702 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 3-isocyano-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | [C-]#[N+]c1c(C)cc(C)[nH]c1=O |
| InChI | InChI=1S/C8H8N2O/c1-5-4-6(2)10-8(11)7(5)9-3/h4H,1-2H3,(H,10,11) |
| InChIKey | RJJQKVKGLYUYJP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 37.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|