C14H12N2O — CID 123526047
4-benzyl-3-isocyano-6-methyl-1H-pyridin-2-one (PubChem CID 123526047) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-benzyl-3-isocyano-6-methyl-1H-pyridin-2-one.
| Compound Name | 4-benzyl-3-isocyano-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123526047 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-benzyl-3-isocyano-6-methyl-1H-pyridin-2-one |
| SMILES | [C-]#[N+]c1c(Cc2ccccc2)cc(C)[nH]c1=O |
| InChI | InChI=1S/C14H12N2O/c1-10-8-12(13(15-2)14(17)16-10)9-11-6-4-3-5-7-11/h3-8H,9H2,1H3,(H,16,17) |
| InChIKey | AQXHXMDBQGBFNY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|