C20H17N3OS — CID 157250404
5-isocyano-4-(4-methylphenyl)-2-[(3-methylphenyl)methylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 157250404) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 5-isocyano-4-(4-methylphenyl)-2-[(3-methylphenyl)methylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 5-isocyano-4-(4-methylphenyl)-2-[(3-methylphenyl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 157250404 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 5-isocyano-4-(4-methylphenyl)-2-[(3-methylphenyl)methylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | [C-]#[N+]c1c(-c2ccc(C)cc2)nc(SCc2cccc(C)c2)[nH]c1=O |
| InChI | InChI=1S/C20H17N3OS/c1-13-7-9-16(10-8-13)17-18(21-3)19(24)23-20(22-17)25-12-15-6-4-5-14(2)11-15/h4-11H,12H2,1-2H3,(H,22,23,24) |
| InChIKey | VEKNRXHNLBCKRM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 50.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|