C18H14N4OS — CID 157250401
5-isocyano-2-[(3-methylphenyl)methylsulfanyl]-4-pyridin-4-yl-1H-pyrimidin-6-one (PubChem CID 157250401) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is 5-isocyano-2-[(3-methylphenyl)methylsulfanyl]-4-pyridin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 5-isocyano-2-[(3-methylphenyl)methylsulfanyl]-4-pyridin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 157250401 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 5-isocyano-2-[(3-methylphenyl)methylsulfanyl]-4-pyridin-4-yl-1H-pyrimidin-6-one |
| SMILES | [C-]#[N+]c1c(-c2ccncc2)nc(SCc2cccc(C)c2)[nH]c1=O |
| InChI | InChI=1S/C18H14N4OS/c1-12-4-3-5-13(10-12)11-24-18-21-15(14-6-8-20-9-7-14)16(19-2)17(23)22-18/h3-10H,11H2,1H3,(H,21,22,23) |
| InChIKey | IRBABGAAGHGVGR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|